About 4-N,5-dimethyl-2-piperidin-1-ylpyrimidine-4,6-diamine
4-N,5-dimethyl-2-piperidin-1-ylpyrimidine-4,6-diamine (PubChem CID 22329438) has the molecular formula C11H19N5
and a molecular weight of 221.31 g/mol. Its IUPAC name is 4-N,5-dimethyl-2-piperidin-1-ylpyrimidine-4,6-diamine.
Molecular Properties
| Compound Name | 4-N,5-dimethyl-2-piperidin-1-ylpyrimidine-4,6-diamine |
| PubChem CID | 22329438 |
| Molecular Formula | C11H19N5 |
| Molecular Weight | 221.31 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 4-N,5-dimethyl-2-piperidin-1-ylpyrimidine-4,6-diamine |
| SMILES | CNc1nc(N2CCCCC2)nc(N)c1C |
| InChI | InChI=1S/C11H19N5/c1-8-9(12)14-11(15-10(8)13-2)16-6-4-3-5-7-16/h3-7H2,1-2H3,(H3,12,13,14,15) |
| InChIKey | JNRUFMXCFBYYMM-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-N,5-dimethyl-2-piperidin-1-ylpyrimidine-4,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N,5-dimethyl-2-piperidin-1-ylpyrimidine-4,6-diamine?
The IUPAC name of 4-N,5-dimethyl-2-piperidin-1-ylpyrimidine-4,6-diamine (CID 22329438) is 4-N,5-dimethyl-2-piperidin-1-ylpyrimidine-4,6-diamine.
What is the SMILES notation for 4-N,5-dimethyl-2-piperidin-1-ylpyrimidine-4,6-diamine?
The canonical SMILES for 4-N,5-dimethyl-2-piperidin-1-ylpyrimidine-4,6-diamine is CNc1nc(N2CCCCC2)nc(N)c1C.
What is the InChIKey of 4-N,5-dimethyl-2-piperidin-1-ylpyrimidine-4,6-diamine?
The InChIKey is JNRUFMXCFBYYMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N5/c1-8-9(12)14-11(15-10(8)13-2)16-6-4-3-5-7-16/h3-7H2,1-2H3,(H3,12,13,14,15).
What are the key properties of 4-N,5-dimethyl-2-piperidin-1-ylpyrimidine-4,6-diamine?
4-N,5-dimethyl-2-piperidin-1-ylpyrimidine-4,6-diamine has a molecular weight of 221.31 g/mol, XLogP of 1.40, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N,5-dimethyl-2-piperidin-1-ylpyrimidine-4,6-diamine is sourced from PubChem (CID 22329438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).