C23H27N5O4 — CID 22329815
6-acetyl-8-cyclopentyl-2-[[5-(2-methoxyethoxymethyl)-2-pyridinyl]amino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 22329815) has the molecular formula C23H27N5O4 and a molecular weight of 437.50 g/mol. Its IUPAC name is 6-acetyl-8-cyclopentyl-2-[[5-(2-methoxyethoxymethyl)-2-pyridinyl]amino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-acetyl-8-cyclopentyl-2-[[5-(2-methoxyethoxymethyl)-2-pyridinyl]amino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 22329815 |
| Molecular Formula | C23H27N5O4 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 6-acetyl-8-cyclopentyl-2-[[5-(2-methoxyethoxymethyl)-2-pyridinyl]amino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | COCCOCc1ccc(Nc2ncc3cc(C(C)=O)c(=O)n(C4CCCC4)c3n2)nc1 |
| InChI | InChI=1S/C23H27N5O4/c1-15(29)19-11-17-13-25-23(27-21(17)28(22(19)30)18-5-3-4-6-18)26-20-8-7-16(12-24-20)14-32-10-9-31-2/h7-8,11-13,18H,3-6,9-10,14H2,1-2H3,(H,24,25,26,27) |
| InChIKey | SUMIDHRKHFHCBN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|