About 2-methoxyethyl 1-[3-(4-ethyl-3,5-dimethylpiperazin-1-yl)phenyl]benzimidazole-5-carboxylate
2-methoxyethyl 1-[3-(4-ethyl-3,5-dimethylpiperazin-1-yl)phenyl]benzimidazole-5-carboxylate (PubChem CID 22330098) has the molecular formula C25H32N4O3
and a molecular weight of 436.56 g/mol. Its IUPAC name is 2-methoxyethyl 1-[3-(4-ethyl-3,5-dimethylpiperazin-1-yl)phenyl]benzimidazole-5-carboxylate.
Molecular Properties
| Compound Name | 2-methoxyethyl 1-[3-(4-ethyl-3,5-dimethylpiperazin-1-yl)phenyl]benzimidazole-5-carboxylate |
| PubChem CID | 22330098 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | 2-methoxyethyl 1-[3-(4-ethyl-3,5-dimethylpiperazin-1-yl)phenyl]benzimidazole-5-carboxylate |
| SMILES | CCN1C(C)CN(c2cccc(-n3cnc4cc(C(=O)OCCOC)ccc43)c2)CC1C |
| InChI | InChI=1S/C25H32N4O3/c1-5-28-18(2)15-27(16-19(28)3)21-7-6-8-22(14-21)29-17-26-23-13-20(9-10-24(23)29)25(30)32-12-11-31-4/h6-10,13-14,17-19H,5,11-12,15-16H2,1-4H3 |
| InChIKey | JEGSASOSWHBLPL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 59.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyethyl 1-[3-(4-ethyl-3,5-dimethylpiperazin-1-yl)phenyl]benzimidazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyethyl 1-[3-(4-ethyl-3,5-dimethylpiperazin-1-yl)phenyl]benzimidazole-5-carboxylate?
The IUPAC name of 2-methoxyethyl 1-[3-(4-ethyl-3,5-dimethylpiperazin-1-yl)phenyl]benzimidazole-5-carboxylate (CID 22330098) is 2-methoxyethyl 1-[3-(4-ethyl-3,5-dimethylpiperazin-1-yl)phenyl]benzimidazole-5-carboxylate.
What is the SMILES notation for 2-methoxyethyl 1-[3-(4-ethyl-3,5-dimethylpiperazin-1-yl)phenyl]benzimidazole-5-carboxylate?
The canonical SMILES for 2-methoxyethyl 1-[3-(4-ethyl-3,5-dimethylpiperazin-1-yl)phenyl]benzimidazole-5-carboxylate is CCN1C(C)CN(c2cccc(-n3cnc4cc(C(=O)OCCOC)ccc43)c2)CC1C.
What is the InChIKey of 2-methoxyethyl 1-[3-(4-ethyl-3,5-dimethylpiperazin-1-yl)phenyl]benzimidazole-5-carboxylate?
The InChIKey is JEGSASOSWHBLPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H32N4O3/c1-5-28-18(2)15-27(16-19(28)3)21-7-6-8-22(14-21)29-17-26-23-13-20(9-10-24(23)29)25(30)32-12-11-31-4/h6-10,13-14,17-19H,5,11-12,15-16H2,1-4H3.
What are the key properties of 2-methoxyethyl 1-[3-(4-ethyl-3,5-dimethylpiperazin-1-yl)phenyl]benzimidazole-5-carboxylate?
2-methoxyethyl 1-[3-(4-ethyl-3,5-dimethylpiperazin-1-yl)phenyl]benzimidazole-5-carboxylate has a molecular weight of 436.56 g/mol, XLogP of 3.75, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyethyl 1-[3-(4-ethyl-3,5-dimethylpiperazin-1-yl)phenyl]benzimidazole-5-carboxylate is sourced from PubChem (CID 22330098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).