About 2-hydroxyethyl 1-[3-(4-methylpiperazin-1-yl)phenyl]benzimidazole-5-carboxylate
2-hydroxyethyl 1-[3-(4-methylpiperazin-1-yl)phenyl]benzimidazole-5-carboxylate (PubChem CID 22330133) has the molecular formula C21H24N4O3
and a molecular weight of 380.45 g/mol. Its IUPAC name is 2-hydroxyethyl 1-[3-(4-methylpiperazin-1-yl)phenyl]benzimidazole-5-carboxylate.
Molecular Properties
| Compound Name | 2-hydroxyethyl 1-[3-(4-methylpiperazin-1-yl)phenyl]benzimidazole-5-carboxylate |
| PubChem CID | 22330133 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 2-hydroxyethyl 1-[3-(4-methylpiperazin-1-yl)phenyl]benzimidazole-5-carboxylate |
| SMILES | CN1CCN(c2cccc(-n3cnc4cc(C(=O)OCCO)ccc43)c2)CC1 |
| InChI | InChI=1S/C21H24N4O3/c1-23-7-9-24(10-8-23)17-3-2-4-18(14-17)25-15-22-19-13-16(5-6-20(19)25)21(27)28-12-11-26/h2-6,13-15,26H,7-12H2,1H3 |
| InChIKey | LEJVFMZLPOVVKR-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-hydroxyethyl 1-[3-(4-methylpiperazin-1-yl)phenyl]benzimidazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl 1-[3-(4-methylpiperazin-1-yl)phenyl]benzimidazole-5-carboxylate?
The IUPAC name of 2-hydroxyethyl 1-[3-(4-methylpiperazin-1-yl)phenyl]benzimidazole-5-carboxylate (CID 22330133) is 2-hydroxyethyl 1-[3-(4-methylpiperazin-1-yl)phenyl]benzimidazole-5-carboxylate.
What is the SMILES notation for 2-hydroxyethyl 1-[3-(4-methylpiperazin-1-yl)phenyl]benzimidazole-5-carboxylate?
The canonical SMILES for 2-hydroxyethyl 1-[3-(4-methylpiperazin-1-yl)phenyl]benzimidazole-5-carboxylate is CN1CCN(c2cccc(-n3cnc4cc(C(=O)OCCO)ccc43)c2)CC1.
What is the InChIKey of 2-hydroxyethyl 1-[3-(4-methylpiperazin-1-yl)phenyl]benzimidazole-5-carboxylate?
The InChIKey is LEJVFMZLPOVVKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N4O3/c1-23-7-9-24(10-8-23)17-3-2-4-18(14-17)25-15-22-19-13-16(5-6-20(19)25)21(27)28-12-11-26/h2-6,13-15,26H,7-12H2,1H3.
What are the key properties of 2-hydroxyethyl 1-[3-(4-methylpiperazin-1-yl)phenyl]benzimidazole-5-carboxylate?
2-hydroxyethyl 1-[3-(4-methylpiperazin-1-yl)phenyl]benzimidazole-5-carboxylate has a molecular weight of 380.45 g/mol, XLogP of 1.93, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl 1-[3-(4-methylpiperazin-1-yl)phenyl]benzimidazole-5-carboxylate is sourced from PubChem (CID 22330133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).