C25H25N3O3 — CID 22330411
N-(2,4-dimethylphenyl)-2-(3,4,5-trimethoxyphenyl)quinazolin-4-amine (PubChem CID 22330411) has the molecular formula C25H25N3O3 and a molecular weight of 415.49 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2-(3,4,5-trimethoxyphenyl)quinazolin-4-amine.
| Compound Name | N-(2,4-dimethylphenyl)-2-(3,4,5-trimethoxyphenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 22330411 |
| Molecular Formula | C25H25N3O3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2-(3,4,5-trimethoxyphenyl)quinazolin-4-amine |
| SMILES | COc1cc(-c2nc(Nc3ccc(C)cc3C)c3ccccc3n2)cc(OC)c1OC |
| InChI | InChI=1S/C25H25N3O3/c1-15-10-11-19(16(2)12-15)26-25-18-8-6-7-9-20(18)27-24(28-25)17-13-21(29-3)23(31-5)22(14-17)30-4/h6-14H,1-5H3,(H,26,27,28) |
| InChIKey | YEWQWKFFNNLMSZ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |