About 2-(3,4-dimethoxyphenyl)-N-(3,5-dimethylphenyl)quinazolin-4-amine
2-(3,4-dimethoxyphenyl)-N-(3,5-dimethylphenyl)quinazolin-4-amine (PubChem CID 22330512) has the molecular formula C24H23N3O2
and a molecular weight of 385.47 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-(3,5-dimethylphenyl)quinazolin-4-amine.
Molecular Properties
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-(3,5-dimethylphenyl)quinazolin-4-amine |
| PubChem CID | 22330512 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-(3,5-dimethylphenyl)quinazolin-4-amine |
| SMILES | COc1ccc(-c2nc(Nc3cc(C)cc(C)c3)c3ccccc3n2)cc1OC |
| InChI | InChI=1S/C24H23N3O2/c1-15-11-16(2)13-18(12-15)25-24-19-7-5-6-8-20(19)26-23(27-24)17-9-10-21(28-3)22(14-17)29-4/h5-14H,1-4H3,(H,25,26,27) |
| InChIKey | XAQVJOKZVUPLNS-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3,4-dimethoxyphenyl)-N-(3,5-dimethylphenyl)quinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethoxyphenyl)-N-(3,5-dimethylphenyl)quinazolin-4-amine?
The IUPAC name of 2-(3,4-dimethoxyphenyl)-N-(3,5-dimethylphenyl)quinazolin-4-amine (CID 22330512) is 2-(3,4-dimethoxyphenyl)-N-(3,5-dimethylphenyl)quinazolin-4-amine.
What is the SMILES notation for 2-(3,4-dimethoxyphenyl)-N-(3,5-dimethylphenyl)quinazolin-4-amine?
The canonical SMILES for 2-(3,4-dimethoxyphenyl)-N-(3,5-dimethylphenyl)quinazolin-4-amine is COc1ccc(-c2nc(Nc3cc(C)cc(C)c3)c3ccccc3n2)cc1OC.
What is the InChIKey of 2-(3,4-dimethoxyphenyl)-N-(3,5-dimethylphenyl)quinazolin-4-amine?
The InChIKey is XAQVJOKZVUPLNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23N3O2/c1-15-11-16(2)13-18(12-15)25-24-19-7-5-6-8-20(19)26-23(27-24)17-9-10-21(28-3)22(14-17)29-4/h5-14H,1-4H3,(H,25,26,27).
What are the key properties of 2-(3,4-dimethoxyphenyl)-N-(3,5-dimethylphenyl)quinazolin-4-amine?
2-(3,4-dimethoxyphenyl)-N-(3,5-dimethylphenyl)quinazolin-4-amine has a molecular weight of 385.47 g/mol, XLogP of 5.67, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethoxyphenyl)-N-(3,5-dimethylphenyl)quinazolin-4-amine is sourced from PubChem (CID 22330512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).