C23H18FN5O3 — CID 22331264
N-[5-[(4-fluorobenzoyl)amino]-2-phenyl-1,2,4-triazol-3-yl]-4-methoxybenzamide (PubChem CID 22331264) has the molecular formula C23H18FN5O3 and a molecular weight of 431.43 g/mol. Its IUPAC name is N-[5-[(4-fluorobenzoyl)amino]-2-phenyl-1,2,4-triazol-3-yl]-4-methoxybenzamide.
| Compound Name | N-[5-[(4-fluorobenzoyl)amino]-2-phenyl-1,2,4-triazol-3-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 22331264 |
| Molecular Formula | C23H18FN5O3 |
| Molecular Weight | 431.43 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | N-[5-[(4-fluorobenzoyl)amino]-2-phenyl-1,2,4-triazol-3-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2nc(NC(=O)c3ccc(F)cc3)nn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H18FN5O3/c1-32-19-13-9-16(10-14-19)21(31)26-23-27-22(28-29(23)18-5-3-2-4-6-18)25-20(30)15-7-11-17(24)12-8-15/h2-14H,1H3,(H2,25,26,27,28,30,31) |
| InChIKey | UWDCAFSARDUOHW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |