C14H21N3O5S — CID 22331382
5-(2-ethoxyethyl)-4-hydroxy-2-(2-morpholin-4-yl-2-oxoethyl)sulfanyl-1H-pyrimidin-6-one (PubChem CID 22331382) has the molecular formula C14H21N3O5S and a molecular weight of 343.41 g/mol. Its IUPAC name is 5-(2-ethoxyethyl)-4-hydroxy-2-(2-morpholin-4-yl-2-oxoethyl)sulfanyl-1H-pyrimidin-6-one.
| Compound Name | 5-(2-ethoxyethyl)-4-hydroxy-2-(2-morpholin-4-yl-2-oxoethyl)sulfanyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 22331382 |
| Molecular Formula | C14H21N3O5S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 5-(2-ethoxyethyl)-4-hydroxy-2-(2-morpholin-4-yl-2-oxoethyl)sulfanyl-1H-pyrimidin-6-one |
| SMILES | CCOCCc1c(O)nc(SCC(=O)N2CCOCC2)[nH]c1=O |
| InChI | InChI=1S/C14H21N3O5S/c1-2-21-6-3-10-12(19)15-14(16-13(10)20)23-9-11(18)17-4-7-22-8-5-17/h2-9H2,1H3,(H2,15,16,19,20) |
| InChIKey | ZROIYVQGSGFAKL-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 104.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|