C18H22BrN5O3 — CID 22331707
1-[(3-bromophenyl)methyl]-8-(3-methoxypropylamino)-3,7-dimethylpurine-2,6-dione (PubChem CID 22331707) has the molecular formula C18H22BrN5O3 and a molecular weight of 436.31 g/mol. Its IUPAC name is 1-[(3-bromophenyl)methyl]-8-(3-methoxypropylamino)-3,7-dimethylpurine-2,6-dione.
| Compound Name | 1-[(3-bromophenyl)methyl]-8-(3-methoxypropylamino)-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 22331707 |
| Molecular Formula | C18H22BrN5O3 |
| Molecular Weight | 436.31 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | 1-[(3-bromophenyl)methyl]-8-(3-methoxypropylamino)-3,7-dimethylpurine-2,6-dione |
| SMILES | COCCCNc1nc2c(c(=O)n(Cc3cccc(Br)c3)c(=O)n2C)n1C |
| InChI | InChI=1S/C18H22BrN5O3/c1-22-14-15(21-17(22)20-8-5-9-27-3)23(2)18(26)24(16(14)25)11-12-6-4-7-13(19)10-12/h4,6-7,10H,5,8-9,11H2,1-3H3,(H,20,21) |
| InChIKey | BAMXBMASYCFXLL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 83.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|