C5H10S2 — CID 22332
2,2-dimethyl-1,3-dithiolane (PubChem CID 22332) has the molecular formula C5H10S2 and a molecular weight of 134.27 g/mol. Its IUPAC name is 2,2-dimethyl-1,3-dithiolane.
| Compound Name | 2,2-dimethyl-1,3-dithiolane |
|---|---|
| PubChem CID | 22332 |
| Molecular Formula | C5H10S2 |
| Molecular Weight | 134.27 g/mol |
| Exact Mass | 134.02 |
| IUPAC Name | 2,2-dimethyl-1,3-dithiolane |
| SMILES | CC1(C)SCCS1 |
| InChI | InChI=1S/C5H10S2/c1-5(2)6-3-4-7-5/h3-4H2,1-2H3 |
| InChIKey | HEDYXMHGMMWNBO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |