About 2-[3-(2,6-dimethylmorpholin-4-yl)quinoxalin-2-yl]sulfanyl-N-(4-ethoxyphenyl)acetamide
2-[3-(2,6-dimethylmorpholin-4-yl)quinoxalin-2-yl]sulfanyl-N-(4-ethoxyphenyl)acetamide (PubChem CID 22332562) has the molecular formula C24H28N4O3S
and a molecular weight of 452.58 g/mol. Its IUPAC name is 2-[3-(2,6-dimethylmorpholin-4-yl)quinoxalin-2-yl]sulfanyl-N-(4-ethoxyphenyl)acetamide.
Molecular Properties
| Compound Name | 2-[3-(2,6-dimethylmorpholin-4-yl)quinoxalin-2-yl]sulfanyl-N-(4-ethoxyphenyl)acetamide |
| PubChem CID | 22332562 |
| Molecular Formula | C24H28N4O3S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 2-[3-(2,6-dimethylmorpholin-4-yl)quinoxalin-2-yl]sulfanyl-N-(4-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(NC(=O)CSc2nc3ccccc3nc2N2CC(C)OC(C)C2)cc1 |
| InChI | InChI=1S/C24H28N4O3S/c1-4-30-19-11-9-18(10-12-19)25-22(29)15-32-24-23(28-13-16(2)31-17(3)14-28)26-20-7-5-6-8-21(20)27-24/h5-12,16-17H,4,13-15H2,1-3H3,(H,25,29) |
| InChIKey | AJZFMGQYVOSHPJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[3-(2,6-dimethylmorpholin-4-yl)quinoxalin-2-yl]sulfanyl-N-(4-ethoxyphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(2,6-dimethylmorpholin-4-yl)quinoxalin-2-yl]sulfanyl-N-(4-ethoxyphenyl)acetamide?
The IUPAC name of 2-[3-(2,6-dimethylmorpholin-4-yl)quinoxalin-2-yl]sulfanyl-N-(4-ethoxyphenyl)acetamide (CID 22332562) is 2-[3-(2,6-dimethylmorpholin-4-yl)quinoxalin-2-yl]sulfanyl-N-(4-ethoxyphenyl)acetamide.
What is the SMILES notation for 2-[3-(2,6-dimethylmorpholin-4-yl)quinoxalin-2-yl]sulfanyl-N-(4-ethoxyphenyl)acetamide?
The canonical SMILES for 2-[3-(2,6-dimethylmorpholin-4-yl)quinoxalin-2-yl]sulfanyl-N-(4-ethoxyphenyl)acetamide is CCOc1ccc(NC(=O)CSc2nc3ccccc3nc2N2CC(C)OC(C)C2)cc1.
What is the InChIKey of 2-[3-(2,6-dimethylmorpholin-4-yl)quinoxalin-2-yl]sulfanyl-N-(4-ethoxyphenyl)acetamide?
The InChIKey is AJZFMGQYVOSHPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28N4O3S/c1-4-30-19-11-9-18(10-12-19)25-22(29)15-32-24-23(28-13-16(2)31-17(3)14-28)26-20-7-5-6-8-21(20)27-24/h5-12,16-17H,4,13-15H2,1-3H3,(H,25,29).
What are the key properties of 2-[3-(2,6-dimethylmorpholin-4-yl)quinoxalin-2-yl]sulfanyl-N-(4-ethoxyphenyl)acetamide?
2-[3-(2,6-dimethylmorpholin-4-yl)quinoxalin-2-yl]sulfanyl-N-(4-ethoxyphenyl)acetamide has a molecular weight of 452.58 g/mol, XLogP of 4.37, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2,6-dimethylmorpholin-4-yl)quinoxalin-2-yl]sulfanyl-N-(4-ethoxyphenyl)acetamide is sourced from PubChem (CID 22332562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).