About 2-[3-(2,6-dimethylmorpholin-4-yl)quinoxalin-2-yl]sulfanyl-N-(3-methylphenyl)acetamide
2-[3-(2,6-dimethylmorpholin-4-yl)quinoxalin-2-yl]sulfanyl-N-(3-methylphenyl)acetamide (PubChem CID 22332563) has the molecular formula C23H26N4O2S
and a molecular weight of 422.55 g/mol. Its IUPAC name is 2-[3-(2,6-dimethylmorpholin-4-yl)quinoxalin-2-yl]sulfanyl-N-(3-methylphenyl)acetamide.
Molecular Properties
| Compound Name | 2-[3-(2,6-dimethylmorpholin-4-yl)quinoxalin-2-yl]sulfanyl-N-(3-methylphenyl)acetamide |
| PubChem CID | 22332563 |
| Molecular Formula | C23H26N4O2S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 2-[3-(2,6-dimethylmorpholin-4-yl)quinoxalin-2-yl]sulfanyl-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)CSc2nc3ccccc3nc2N2CC(C)OC(C)C2)c1 |
| InChI | InChI=1S/C23H26N4O2S/c1-15-7-6-8-18(11-15)24-21(28)14-30-23-22(27-12-16(2)29-17(3)13-27)25-19-9-4-5-10-20(19)26-23/h4-11,16-17H,12-14H2,1-3H3,(H,24,28) |
| InChIKey | MSGTULUVTCRSTG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[3-(2,6-dimethylmorpholin-4-yl)quinoxalin-2-yl]sulfanyl-N-(3-methylphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(2,6-dimethylmorpholin-4-yl)quinoxalin-2-yl]sulfanyl-N-(3-methylphenyl)acetamide?
The IUPAC name of 2-[3-(2,6-dimethylmorpholin-4-yl)quinoxalin-2-yl]sulfanyl-N-(3-methylphenyl)acetamide (CID 22332563) is 2-[3-(2,6-dimethylmorpholin-4-yl)quinoxalin-2-yl]sulfanyl-N-(3-methylphenyl)acetamide.
What is the SMILES notation for 2-[3-(2,6-dimethylmorpholin-4-yl)quinoxalin-2-yl]sulfanyl-N-(3-methylphenyl)acetamide?
The canonical SMILES for 2-[3-(2,6-dimethylmorpholin-4-yl)quinoxalin-2-yl]sulfanyl-N-(3-methylphenyl)acetamide is Cc1cccc(NC(=O)CSc2nc3ccccc3nc2N2CC(C)OC(C)C2)c1.
What is the InChIKey of 2-[3-(2,6-dimethylmorpholin-4-yl)quinoxalin-2-yl]sulfanyl-N-(3-methylphenyl)acetamide?
The InChIKey is MSGTULUVTCRSTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N4O2S/c1-15-7-6-8-18(11-15)24-21(28)14-30-23-22(27-12-16(2)29-17(3)13-27)25-19-9-4-5-10-20(19)26-23/h4-11,16-17H,12-14H2,1-3H3,(H,24,28).
What are the key properties of 2-[3-(2,6-dimethylmorpholin-4-yl)quinoxalin-2-yl]sulfanyl-N-(3-methylphenyl)acetamide?
2-[3-(2,6-dimethylmorpholin-4-yl)quinoxalin-2-yl]sulfanyl-N-(3-methylphenyl)acetamide has a molecular weight of 422.55 g/mol, XLogP of 4.28, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2,6-dimethylmorpholin-4-yl)quinoxalin-2-yl]sulfanyl-N-(3-methylphenyl)acetamide is sourced from PubChem (CID 22332563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).