About N-(3,5-dimethylphenyl)-2-(3-piperidin-1-ylquinoxalin-2-yl)sulfanylacetamide
N-(3,5-dimethylphenyl)-2-(3-piperidin-1-ylquinoxalin-2-yl)sulfanylacetamide (PubChem CID 22332588) has the molecular formula C23H26N4OS
and a molecular weight of 406.56 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-2-(3-piperidin-1-ylquinoxalin-2-yl)sulfanylacetamide.
Molecular Properties
| Compound Name | N-(3,5-dimethylphenyl)-2-(3-piperidin-1-ylquinoxalin-2-yl)sulfanylacetamide |
| PubChem CID | 22332588 |
| Molecular Formula | C23H26N4OS |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | N-(3,5-dimethylphenyl)-2-(3-piperidin-1-ylquinoxalin-2-yl)sulfanylacetamide |
| SMILES | Cc1cc(C)cc(NC(=O)CSc2nc3ccccc3nc2N2CCCCC2)c1 |
| InChI | InChI=1S/C23H26N4OS/c1-16-12-17(2)14-18(13-16)24-21(28)15-29-23-22(27-10-6-3-7-11-27)25-19-8-4-5-9-20(19)26-23/h4-5,8-9,12-14H,3,6-7,10-11,15H2,1-2H3,(H,24,28) |
| InChIKey | XKGYWYCYFKLPGG-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(3,5-dimethylphenyl)-2-(3-piperidin-1-ylquinoxalin-2-yl)sulfanylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,5-dimethylphenyl)-2-(3-piperidin-1-ylquinoxalin-2-yl)sulfanylacetamide?
The IUPAC name of N-(3,5-dimethylphenyl)-2-(3-piperidin-1-ylquinoxalin-2-yl)sulfanylacetamide (CID 22332588) is N-(3,5-dimethylphenyl)-2-(3-piperidin-1-ylquinoxalin-2-yl)sulfanylacetamide.
What is the SMILES notation for N-(3,5-dimethylphenyl)-2-(3-piperidin-1-ylquinoxalin-2-yl)sulfanylacetamide?
The canonical SMILES for N-(3,5-dimethylphenyl)-2-(3-piperidin-1-ylquinoxalin-2-yl)sulfanylacetamide is Cc1cc(C)cc(NC(=O)CSc2nc3ccccc3nc2N2CCCCC2)c1.
What is the InChIKey of N-(3,5-dimethylphenyl)-2-(3-piperidin-1-ylquinoxalin-2-yl)sulfanylacetamide?
The InChIKey is XKGYWYCYFKLPGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N4OS/c1-16-12-17(2)14-18(13-16)24-21(28)15-29-23-22(27-10-6-3-7-11-27)25-19-8-4-5-9-20(19)26-23/h4-5,8-9,12-14H,3,6-7,10-11,15H2,1-2H3,(H,24,28).
What are the key properties of N-(3,5-dimethylphenyl)-2-(3-piperidin-1-ylquinoxalin-2-yl)sulfanylacetamide?
N-(3,5-dimethylphenyl)-2-(3-piperidin-1-ylquinoxalin-2-yl)sulfanylacetamide has a molecular weight of 406.56 g/mol, XLogP of 4.97, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,5-dimethylphenyl)-2-(3-piperidin-1-ylquinoxalin-2-yl)sulfanylacetamide is sourced from PubChem (CID 22332588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).