C22H30N4OS — CID 22332666
1-(azepan-1-yl)-2-[3-(4-methylpiperidin-1-yl)quinoxalin-2-yl]sulfanylethanone (PubChem CID 22332666) has the molecular formula C22H30N4OS and a molecular weight of 398.58 g/mol. Its IUPAC name is 1-(azepan-1-yl)-2-[3-(4-methylpiperidin-1-yl)quinoxalin-2-yl]sulfanylethanone.
| Compound Name | 1-(azepan-1-yl)-2-[3-(4-methylpiperidin-1-yl)quinoxalin-2-yl]sulfanylethanone |
|---|---|
| PubChem CID | 22332666 |
| Molecular Formula | C22H30N4OS |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 1-(azepan-1-yl)-2-[3-(4-methylpiperidin-1-yl)quinoxalin-2-yl]sulfanylethanone |
| SMILES | CC1CCN(c2nc3ccccc3nc2SCC(=O)N2CCCCCC2)CC1 |
| InChI | InChI=1S/C22H30N4OS/c1-17-10-14-26(15-11-17)21-22(24-19-9-5-4-8-18(19)23-21)28-16-20(27)25-12-6-2-3-7-13-25/h4-5,8-9,17H,2-3,6-7,10-16H2,1H3 |
| InChIKey | BZCCWZUMUWUYJZ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |