About 3-(3-methylbenzo[g][1,2]benzothiazol-2-ium-2-yl)propane-1-sulfonate
3-(3-methylbenzo[g][1,2]benzothiazol-2-ium-2-yl)propane-1-sulfonate (PubChem CID 22332861) has the molecular formula C15H15NO3S2
and a molecular weight of 321.42 g/mol. Its IUPAC name is 3-(3-methylbenzo[g][1,2]benzothiazol-2-ium-2-yl)propane-1-sulfonate.
Molecular Properties
| Compound Name | 3-(3-methylbenzo[g][1,2]benzothiazol-2-ium-2-yl)propane-1-sulfonate |
| PubChem CID | 22332861 |
| Molecular Formula | C15H15NO3S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 3-(3-methylbenzo[g][1,2]benzothiazol-2-ium-2-yl)propane-1-sulfonate |
| SMILES | Cc1c2ccc3ccccc3c2s[n+]1CCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C15H15NO3S2/c1-11-13-8-7-12-5-2-3-6-14(12)15(13)20-16(11)9-4-10-21(17,18)19/h2-3,5-8H,4,9-10H2,1H3 |
| InChIKey | ULYQRXRZCNTXTH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 61.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-methylbenzo[g][1,2]benzothiazol-2-ium-2-yl)propane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methylbenzo[g][1,2]benzothiazol-2-ium-2-yl)propane-1-sulfonate?
The IUPAC name of 3-(3-methylbenzo[g][1,2]benzothiazol-2-ium-2-yl)propane-1-sulfonate (CID 22332861) is 3-(3-methylbenzo[g][1,2]benzothiazol-2-ium-2-yl)propane-1-sulfonate.
What is the SMILES notation for 3-(3-methylbenzo[g][1,2]benzothiazol-2-ium-2-yl)propane-1-sulfonate?
The canonical SMILES for 3-(3-methylbenzo[g][1,2]benzothiazol-2-ium-2-yl)propane-1-sulfonate is Cc1c2ccc3ccccc3c2s[n+]1CCCS(=O)(=O)[O-].
What is the InChIKey of 3-(3-methylbenzo[g][1,2]benzothiazol-2-ium-2-yl)propane-1-sulfonate?
The InChIKey is ULYQRXRZCNTXTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO3S2/c1-11-13-8-7-12-5-2-3-6-14(12)15(13)20-16(11)9-4-10-21(17,18)19/h2-3,5-8H,4,9-10H2,1H3.
What are the key properties of 3-(3-methylbenzo[g][1,2]benzothiazol-2-ium-2-yl)propane-1-sulfonate?
3-(3-methylbenzo[g][1,2]benzothiazol-2-ium-2-yl)propane-1-sulfonate has a molecular weight of 321.42 g/mol, XLogP of 2.59, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methylbenzo[g][1,2]benzothiazol-2-ium-2-yl)propane-1-sulfonate is sourced from PubChem (CID 22332861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).