C29H28Cl2FNO2 — CID 22333802
10-(3,4-dichlorophenyl)-9-(3-fluorophenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 22333802) has the molecular formula C29H28Cl2FNO2 and a molecular weight of 512.45 g/mol. Its IUPAC name is 10-(3,4-dichlorophenyl)-9-(3-fluorophenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 10-(3,4-dichlorophenyl)-9-(3-fluorophenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 22333802 |
| Molecular Formula | C29H28Cl2FNO2 |
| Molecular Weight | 512.45 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | 10-(3,4-dichlorophenyl)-9-(3-fluorophenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(c1ccc(Cl)c(Cl)c1)C1=C(C(=O)CC(C)(C)C1)C2c1cccc(F)c1 |
| InChI | InChI=1S/C29H28Cl2FNO2/c1-28(2)12-21-26(23(34)14-28)25(16-6-5-7-17(32)10-16)27-22(13-29(3,4)15-24(27)35)33(21)18-8-9-19(30)20(31)11-18/h5-11,25H,12-15H2,1-4H3 |
| InChIKey | GPQRVJGCDPXTOF-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.45 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |