C27H30N4O5 — CID 22334057
N-[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]-3-(2,4-dimethoxyphenyl)-4-oxophthalazine-1-carboxamide (PubChem CID 22334057) has the molecular formula C27H30N4O5 and a molecular weight of 490.56 g/mol. Its IUPAC name is N-[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]-3-(2,4-dimethoxyphenyl)-4-oxophthalazine-1-carboxamide.
| Compound Name | N-[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]-3-(2,4-dimethoxyphenyl)-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 22334057 |
| Molecular Formula | C27H30N4O5 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | N-[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]-3-(2,4-dimethoxyphenyl)-4-oxophthalazine-1-carboxamide |
| SMILES | COc1ccc(-n2nc(C(=O)NCC(=O)NCCC3=CCCCC3)c3ccccc3c2=O)c(OC)c1 |
| InChI | InChI=1S/C27H30N4O5/c1-35-19-12-13-22(23(16-19)36-2)31-27(34)21-11-7-6-10-20(21)25(30-31)26(33)29-17-24(32)28-15-14-18-8-4-3-5-9-18/h6-8,10-13,16H,3-5,9,14-15,17H2,1-2H3,(H,28,32)(H,29,33) |
| InChIKey | MXCXIFICVIHPFK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|