About 5-[(4-methylsulfanylphenyl)methyl]-3,4-dihydro-2H-pyrrole
5-[(4-methylsulfanylphenyl)methyl]-3,4-dihydro-2H-pyrrole (PubChem CID 22335642) has the molecular formula C12H15NS
and a molecular weight of 205.33 g/mol. Its IUPAC name is 5-[(4-methylsulfanylphenyl)methyl]-3,4-dihydro-2H-pyrrole.
Molecular Properties
| Compound Name | 5-[(4-methylsulfanylphenyl)methyl]-3,4-dihydro-2H-pyrrole |
| PubChem CID | 22335642 |
| Molecular Formula | C12H15NS |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 5-[(4-methylsulfanylphenyl)methyl]-3,4-dihydro-2H-pyrrole |
| SMILES | CSc1ccc(CC2=NCCC2)cc1 |
| InChI | InChI=1S/C12H15NS/c1-14-12-6-4-10(5-7-12)9-11-3-2-8-13-11/h4-7H,2-3,8-9H2,1H3 |
| InChIKey | RKBMKGLWKJEOEP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[(4-methylsulfanylphenyl)methyl]-3,4-dihydro-2H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4-methylsulfanylphenyl)methyl]-3,4-dihydro-2H-pyrrole?
The IUPAC name of 5-[(4-methylsulfanylphenyl)methyl]-3,4-dihydro-2H-pyrrole (CID 22335642) is 5-[(4-methylsulfanylphenyl)methyl]-3,4-dihydro-2H-pyrrole.
What is the SMILES notation for 5-[(4-methylsulfanylphenyl)methyl]-3,4-dihydro-2H-pyrrole?
The canonical SMILES for 5-[(4-methylsulfanylphenyl)methyl]-3,4-dihydro-2H-pyrrole is CSc1ccc(CC2=NCCC2)cc1.
What is the InChIKey of 5-[(4-methylsulfanylphenyl)methyl]-3,4-dihydro-2H-pyrrole?
The InChIKey is RKBMKGLWKJEOEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NS/c1-14-12-6-4-10(5-7-12)9-11-3-2-8-13-11/h4-7H,2-3,8-9H2,1H3.
What are the key properties of 5-[(4-methylsulfanylphenyl)methyl]-3,4-dihydro-2H-pyrrole?
5-[(4-methylsulfanylphenyl)methyl]-3,4-dihydro-2H-pyrrole has a molecular weight of 205.33 g/mol, XLogP of 3.19, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4-methylsulfanylphenyl)methyl]-3,4-dihydro-2H-pyrrole is sourced from PubChem (CID 22335642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).