About 3,5,6,7-tetrahydro-2H-pyrrolo[1,2-a]imidazole
3,5,6,7-tetrahydro-2H-pyrrolo[1,2-a]imidazole (PubChem CID 22335745) has the molecular formula C6H10N2
and a molecular weight of 110.16 g/mol. Its IUPAC name is 3,5,6,7-tetrahydro-2H-pyrrolo[1,2-a]imidazole.
Analyze 3,5,6,7-tetrahydro-2H-pyrrolo[1,2-a]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5,6,7-tetrahydro-2H-pyrrolo[1,2-a]imidazole?
The IUPAC name of 3,5,6,7-tetrahydro-2H-pyrrolo[1,2-a]imidazole (CID 22335745) is 3,5,6,7-tetrahydro-2H-pyrrolo[1,2-a]imidazole.
What is the SMILES notation for 3,5,6,7-tetrahydro-2H-pyrrolo[1,2-a]imidazole?
The canonical SMILES for 3,5,6,7-tetrahydro-2H-pyrrolo[1,2-a]imidazole is C1CC2=NCCN2C1.
What is the InChIKey of 3,5,6,7-tetrahydro-2H-pyrrolo[1,2-a]imidazole?
The InChIKey is NGENSVOAXQDAGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2/c1-2-6-7-3-5-8(6)4-1/h1-5H2.
What are the key properties of 3,5,6,7-tetrahydro-2H-pyrrolo[1,2-a]imidazole?
3,5,6,7-tetrahydro-2H-pyrrolo[1,2-a]imidazole has a molecular weight of 110.16 g/mol, XLogP of 0.49, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5,6,7-tetrahydro-2H-pyrrolo[1,2-a]imidazole is sourced from PubChem (CID 22335745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).