About 4-oxo-4λ4-thia-1-azabicyclo[3.2.0]heptan-7-one
4-oxo-4λ4-thia-1-azabicyclo[3.2.0]heptan-7-one (PubChem CID 22336065) has the molecular formula C5H7NO2S
and a molecular weight of 145.18 g/mol. Its IUPAC name is 4-oxo-4λ4-thia-1-azabicyclo[3.2.0]heptan-7-one.
Molecular Properties
| Compound Name | 4-oxo-4λ4-thia-1-azabicyclo[3.2.0]heptan-7-one |
| PubChem CID | 22336065 |
| Molecular Formula | C5H7NO2S |
| Molecular Weight | 145.18 g/mol |
| Exact Mass | 145.02 |
| IUPAC Name | 4-oxo-4λ4-thia-1-azabicyclo[3.2.0]heptan-7-one |
| SMILES | O=C1CC2N1CCS2=O |
| InChI | InChI=1S/C5H7NO2S/c7-4-3-5-6(4)1-2-9(5)8/h5H,1-3H2 |
| InChIKey | YGOAWQXJVXSSGU-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.18 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-oxo-4λ4-thia-1-azabicyclo[3.2.0]heptan-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-4λ4-thia-1-azabicyclo[3.2.0]heptan-7-one?
The IUPAC name of 4-oxo-4λ4-thia-1-azabicyclo[3.2.0]heptan-7-one (CID 22336065) is 4-oxo-4λ4-thia-1-azabicyclo[3.2.0]heptan-7-one.
What is the SMILES notation for 4-oxo-4λ4-thia-1-azabicyclo[3.2.0]heptan-7-one?
The canonical SMILES for 4-oxo-4λ4-thia-1-azabicyclo[3.2.0]heptan-7-one is O=C1CC2N1CCS2=O.
What is the InChIKey of 4-oxo-4λ4-thia-1-azabicyclo[3.2.0]heptan-7-one?
The InChIKey is YGOAWQXJVXSSGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO2S/c7-4-3-5-6(4)1-2-9(5)8/h5H,1-3H2.
What are the key properties of 4-oxo-4λ4-thia-1-azabicyclo[3.2.0]heptan-7-one?
4-oxo-4λ4-thia-1-azabicyclo[3.2.0]heptan-7-one has a molecular weight of 145.18 g/mol, XLogP of -0.69, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-4λ4-thia-1-azabicyclo[3.2.0]heptan-7-one is sourced from PubChem (CID 22336065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).