C29H27N5O4S — CID 22336174
2-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-(1,3-thiazol-2-yl)phenyl]-5-(2-methylpropylcarbamoyl)benzoic acid (PubChem CID 22336174) has the molecular formula C29H27N5O4S and a molecular weight of 541.63 g/mol. Its IUPAC name is 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-(1,3-thiazol-2-yl)phenyl]-5-(2-methylpropylcarbamoyl)benzoic acid.
| Compound Name | 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-(1,3-thiazol-2-yl)phenyl]-5-(2-methylpropylcarbamoyl)benzoic acid |
|---|---|
| PubChem CID | 22336174 |
| Molecular Formula | C29H27N5O4S |
| Molecular Weight | 541.63 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | 2-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-(1,3-thiazol-2-yl)phenyl]-5-(2-methylpropylcarbamoyl)benzoic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2cc(-c3nccs3)ccc2-c2ccc(C(=O)NCC(C)C)cc2C(=O)O)cc1 |
| InChI | InChI=1S/C29H27N5O4S/c1-16(2)15-33-26(35)18-5-9-22(24(13-18)29(37)38)21-10-6-19(28-32-11-12-39-28)14-23(21)27(36)34-20-7-3-17(4-8-20)25(30)31/h3-14,16H,15H2,1-2H3,(H3,30,31)(H,33,35)(H,34,36)(H,37,38) |
| InChIKey | JHMLZMRJAKCEAM-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 158.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.63 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|