C12H19NO3S — CID 22336195
1-(1,7,7-trimethyl-1',1'-dioxospiro[bicyclo[2.2.1]heptane-2,3'-thiaziridine]-2'-yl)ethanone (PubChem CID 22336195) has the molecular formula C12H19NO3S and a molecular weight of 257.35 g/mol. Its IUPAC name is 1-(1,7,7-trimethyl-1',1'-dioxospiro[bicyclo[2.2.1]heptane-2,3'-thiaziridine]-2'-yl)ethanone.
| Compound Name | 1-(1,7,7-trimethyl-1',1'-dioxospiro[bicyclo[2.2.1]heptane-2,3'-thiaziridine]-2'-yl)ethanone |
|---|---|
| PubChem CID | 22336195 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 1-(1,7,7-trimethyl-1',1'-dioxospiro[bicyclo[2.2.1]heptane-2,3'-thiaziridine]-2'-yl)ethanone |
| SMILES | CC(=O)N1C2(CC3CCC2(C)C3(C)C)S1(=O)=O |
| InChI | InChI=1S/C12H19NO3S/c1-8(14)13-12(17(13,15)16)7-9-5-6-11(12,4)10(9,2)3/h9H,5-7H2,1-4H3 |
| InChIKey | RZZFZASXERWLKF-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 54.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|