C32H22F12O7S2 — CID 22336465
[4-[1,1,2,2,3,3-hexafluoro-3-[4-[4-[1,1,2,2,3,3-hexafluoro-3-(4-methylsulfonyloxyphenyl)propyl]phenoxy]phenyl]propyl]phenyl] methanesulfonate (PubChem CID 22336465) has the molecular formula C32H22F12O7S2 and a molecular weight of 810.63 g/mol. Its IUPAC name is [4-[1,1,2,2,3,3-hexafluoro-3-[4-[4-[1,1,2,2,3,3-hexafluoro-3-(4-methylsulfonyloxyphenyl)propyl]phenoxy]phenyl]propyl]phenyl] methanesulfonate.
| Compound Name | [4-[1,1,2,2,3,3-hexafluoro-3-[4-[4-[1,1,2,2,3,3-hexafluoro-3-(4-methylsulfonyloxyphenyl)propyl]phenoxy]phenyl]propyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 22336465 |
| Molecular Formula | C32H22F12O7S2 |
| Molecular Weight | 810.63 g/mol |
| Exact Mass | 810.06 |
| IUPAC Name | [4-[1,1,2,2,3,3-hexafluoro-3-[4-[4-[1,1,2,2,3,3-hexafluoro-3-(4-methylsulfonyloxyphenyl)propyl]phenoxy]phenyl]propyl]phenyl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1ccc(C(F)(F)C(F)(F)C(F)(F)c2ccc(Oc3ccc(C(F)(F)C(F)(F)C(F)(F)c4ccc(OS(C)(=O)=O)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H22F12O7S2/c1-52(45,46)50-25-15-7-21(8-16-25)29(37,38)31(41,42)27(33,34)19-3-11-23(12-4-19)49-24-13-5-20(6-14-24)28(35,36)32(43,44)30(39,40)22-9-17-26(18-10-22)51-53(2,47)48/h3-18H,1-2H3 |
| InChIKey | NJFFWDSSFPETBE-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.63 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|