About 4-tert-butyl-2,6-bis(methoxymethyl)phenol
4-tert-butyl-2,6-bis(methoxymethyl)phenol (PubChem CID 22336618) has the molecular formula C14H22O3
and a molecular weight of 238.33 g/mol. Its IUPAC name is 4-tert-butyl-2,6-bis(methoxymethyl)phenol.
Molecular Properties
| Compound Name | 4-tert-butyl-2,6-bis(methoxymethyl)phenol |
| PubChem CID | 22336618 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | 4-tert-butyl-2,6-bis(methoxymethyl)phenol |
| SMILES | COCc1cc(C(C)(C)C)cc(COC)c1O |
| InChI | InChI=1S/C14H22O3/c1-14(2,3)12-6-10(8-16-4)13(15)11(7-12)9-17-5/h6-7,15H,8-9H2,1-5H3 |
| InChIKey | SHDBJOYDLRRTRA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-tert-butyl-2,6-bis(methoxymethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-2,6-bis(methoxymethyl)phenol?
The IUPAC name of 4-tert-butyl-2,6-bis(methoxymethyl)phenol (CID 22336618) is 4-tert-butyl-2,6-bis(methoxymethyl)phenol.
What is the SMILES notation for 4-tert-butyl-2,6-bis(methoxymethyl)phenol?
The canonical SMILES for 4-tert-butyl-2,6-bis(methoxymethyl)phenol is COCc1cc(C(C)(C)C)cc(COC)c1O.
What is the InChIKey of 4-tert-butyl-2,6-bis(methoxymethyl)phenol?
The InChIKey is SHDBJOYDLRRTRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O3/c1-14(2,3)12-6-10(8-16-4)13(15)11(7-12)9-17-5/h6-7,15H,8-9H2,1-5H3.
What are the key properties of 4-tert-butyl-2,6-bis(methoxymethyl)phenol?
4-tert-butyl-2,6-bis(methoxymethyl)phenol has a molecular weight of 238.33 g/mol, XLogP of 2.98, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-2,6-bis(methoxymethyl)phenol is sourced from PubChem (CID 22336618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).