About 4-ethenyl-4,6-bis(trifluoromethyl)cyclohexa-1,5-dien-1-ol
4-ethenyl-4,6-bis(trifluoromethyl)cyclohexa-1,5-dien-1-ol (PubChem CID 22336816) has the molecular formula C10H8F6O
and a molecular weight of 258.16 g/mol. Its IUPAC name is 4-ethenyl-4,6-bis(trifluoromethyl)cyclohexa-1,5-dien-1-ol.
Molecular Properties
| Compound Name | 4-ethenyl-4,6-bis(trifluoromethyl)cyclohexa-1,5-dien-1-ol |
| PubChem CID | 22336816 |
| Molecular Formula | C10H8F6O |
| Molecular Weight | 258.16 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 4-ethenyl-4,6-bis(trifluoromethyl)cyclohexa-1,5-dien-1-ol |
| SMILES | C=CC1(C(F)(F)F)C=C(C(F)(F)F)C(O)=CC1 |
| InChI | InChI=1S/C10H8F6O/c1-2-8(10(14,15)16)4-3-7(17)6(5-8)9(11,12)13/h2-3,5,17H,1,4H2 |
| InChIKey | RMJNFSLMJZPDCY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.16 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenyl-4,6-bis(trifluoromethyl)cyclohexa-1,5-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyl-4,6-bis(trifluoromethyl)cyclohexa-1,5-dien-1-ol?
The IUPAC name of 4-ethenyl-4,6-bis(trifluoromethyl)cyclohexa-1,5-dien-1-ol (CID 22336816) is 4-ethenyl-4,6-bis(trifluoromethyl)cyclohexa-1,5-dien-1-ol.
What is the SMILES notation for 4-ethenyl-4,6-bis(trifluoromethyl)cyclohexa-1,5-dien-1-ol?
The canonical SMILES for 4-ethenyl-4,6-bis(trifluoromethyl)cyclohexa-1,5-dien-1-ol is C=CC1(C(F)(F)F)C=C(C(F)(F)F)C(O)=CC1.
What is the InChIKey of 4-ethenyl-4,6-bis(trifluoromethyl)cyclohexa-1,5-dien-1-ol?
The InChIKey is RMJNFSLMJZPDCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F6O/c1-2-8(10(14,15)16)4-3-7(17)6(5-8)9(11,12)13/h2-3,5,17H,1,4H2.
What are the key properties of 4-ethenyl-4,6-bis(trifluoromethyl)cyclohexa-1,5-dien-1-ol?
4-ethenyl-4,6-bis(trifluoromethyl)cyclohexa-1,5-dien-1-ol has a molecular weight of 258.16 g/mol, XLogP of 4.06, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyl-4,6-bis(trifluoromethyl)cyclohexa-1,5-dien-1-ol is sourced from PubChem (CID 22336816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).