About dioxido(oxo)silane;oxozirconium(2+)
dioxido(oxo)silane;oxozirconium(2+) (PubChem CID 22336850) has the molecular formula O4SiZr
and a molecular weight of 183.31 g/mol. Its IUPAC name is dioxido(oxo)silane;oxozirconium(2+).
Molecular Properties
| Compound Name | dioxido(oxo)silane;oxozirconium(2+) |
| PubChem CID | 22336850 |
| Molecular Formula | O4SiZr |
| Molecular Weight | 183.31 g/mol |
| Exact Mass | 181.86 |
| IUPAC Name | dioxido(oxo)silane;oxozirconium(2+) |
| SMILES | O=[Si]([O-])[O-].O=[Zr+2] |
| InChI | InChI=1S/O3Si.O.Zr/c1-4(2)3;;/q-2;;+2 |
| InChIKey | MORPGMXNOFGYKW-UHFFFAOYSA-N |
| XLogP | -3.00 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.31 |
| LogP ≤ 5 | -3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dioxido(oxo)silane;oxozirconium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxido(oxo)silane;oxozirconium(2+)?
The IUPAC name of dioxido(oxo)silane;oxozirconium(2+) (CID 22336850) is dioxido(oxo)silane;oxozirconium(2+).
What is the SMILES notation for dioxido(oxo)silane;oxozirconium(2+)?
The canonical SMILES for dioxido(oxo)silane;oxozirconium(2+) is O=[Si]([O-])[O-].O=[Zr+2].
What is the InChIKey of dioxido(oxo)silane;oxozirconium(2+)?
The InChIKey is MORPGMXNOFGYKW-UHFFFAOYSA-N. The full InChI is InChI=1S/O3Si.O.Zr/c1-4(2)3;;/q-2;;+2.
What are the key properties of dioxido(oxo)silane;oxozirconium(2+)?
dioxido(oxo)silane;oxozirconium(2+) has a molecular weight of 183.31 g/mol, XLogP of -3.00, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dioxido(oxo)silane;oxozirconium(2+) is sourced from PubChem (CID 22336850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).