About 6-(2-chloro-4,5-dimethylphenyl)-4-hydroxy-3-methyl-2-pyridin-2-yl-2H-pyran-5-one
6-(2-chloro-4,5-dimethylphenyl)-4-hydroxy-3-methyl-2-pyridin-2-yl-2H-pyran-5-one (PubChem CID 22336861) has the molecular formula C19H18ClNO3
and a molecular weight of 343.81 g/mol. Its IUPAC name is 6-(2-chloro-4,5-dimethylphenyl)-4-hydroxy-3-methyl-2-pyridin-2-yl-2H-pyran-5-one.
Molecular Properties
| Compound Name | 6-(2-chloro-4,5-dimethylphenyl)-4-hydroxy-3-methyl-2-pyridin-2-yl-2H-pyran-5-one |
| PubChem CID | 22336861 |
| Molecular Formula | C19H18ClNO3 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 6-(2-chloro-4,5-dimethylphenyl)-4-hydroxy-3-methyl-2-pyridin-2-yl-2H-pyran-5-one |
| SMILES | CC1=C(O)C(=O)C(c2cc(C)c(C)cc2Cl)OC1c1ccccn1 |
| InChI | InChI=1S/C19H18ClNO3/c1-10-8-13(14(20)9-11(10)2)19-17(23)16(22)12(3)18(24-19)15-6-4-5-7-21-15/h4-9,18-19,22H,1-3H3 |
| InChIKey | KMIIXIRLYAFWJL-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(2-chloro-4,5-dimethylphenyl)-4-hydroxy-3-methyl-2-pyridin-2-yl-2H-pyran-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-chloro-4,5-dimethylphenyl)-4-hydroxy-3-methyl-2-pyridin-2-yl-2H-pyran-5-one?
The IUPAC name of 6-(2-chloro-4,5-dimethylphenyl)-4-hydroxy-3-methyl-2-pyridin-2-yl-2H-pyran-5-one (CID 22336861) is 6-(2-chloro-4,5-dimethylphenyl)-4-hydroxy-3-methyl-2-pyridin-2-yl-2H-pyran-5-one.
What is the SMILES notation for 6-(2-chloro-4,5-dimethylphenyl)-4-hydroxy-3-methyl-2-pyridin-2-yl-2H-pyran-5-one?
The canonical SMILES for 6-(2-chloro-4,5-dimethylphenyl)-4-hydroxy-3-methyl-2-pyridin-2-yl-2H-pyran-5-one is CC1=C(O)C(=O)C(c2cc(C)c(C)cc2Cl)OC1c1ccccn1.
What is the InChIKey of 6-(2-chloro-4,5-dimethylphenyl)-4-hydroxy-3-methyl-2-pyridin-2-yl-2H-pyran-5-one?
The InChIKey is KMIIXIRLYAFWJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18ClNO3/c1-10-8-13(14(20)9-11(10)2)19-17(23)16(22)12(3)18(24-19)15-6-4-5-7-21-15/h4-9,18-19,22H,1-3H3.
What are the key properties of 6-(2-chloro-4,5-dimethylphenyl)-4-hydroxy-3-methyl-2-pyridin-2-yl-2H-pyran-5-one?
6-(2-chloro-4,5-dimethylphenyl)-4-hydroxy-3-methyl-2-pyridin-2-yl-2H-pyran-5-one has a molecular weight of 343.81 g/mol, XLogP of 4.57, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-chloro-4,5-dimethylphenyl)-4-hydroxy-3-methyl-2-pyridin-2-yl-2H-pyran-5-one is sourced from PubChem (CID 22336861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).