C25H29F3N4OS — CID 22337502
2-[2-(pentylamino)ethyl]-N-[1-(3-pyridin-3-ylphenyl)ethyl]-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide (PubChem CID 22337502) has the molecular formula C25H29F3N4OS and a molecular weight of 490.60 g/mol. Its IUPAC name is 2-[2-(pentylamino)ethyl]-N-[1-(3-pyridin-3-ylphenyl)ethyl]-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[2-(pentylamino)ethyl]-N-[1-(3-pyridin-3-ylphenyl)ethyl]-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 22337502 |
| Molecular Formula | C25H29F3N4OS |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | 2-[2-(pentylamino)ethyl]-N-[1-(3-pyridin-3-ylphenyl)ethyl]-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide |
| SMILES | CCCCCNCCc1nc(C(F)(F)F)c(C(=O)NC(C)c2cccc(-c3cccnc3)c2)s1 |
| InChI | InChI=1S/C25H29F3N4OS/c1-3-4-5-12-29-14-11-21-32-23(25(26,27)28)22(34-21)24(33)31-17(2)18-8-6-9-19(15-18)20-10-7-13-30-16-20/h6-10,13,15-17,29H,3-5,11-12,14H2,1-2H3,(H,31,33) |
| InChIKey | SJYYNYSREXLYOB-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|