C13H16ClN — CID 22337597
8-(3-chlorophenyl)-8-azabicyclo[3.2.1]octane (PubChem CID 22337597) has the molecular formula C13H16ClN and a molecular weight of 221.73 g/mol. Its IUPAC name is 8-(3-chlorophenyl)-8-azabicyclo[3.2.1]octane.
| Compound Name | 8-(3-chlorophenyl)-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 22337597 |
| Molecular Formula | C13H16ClN |
| Molecular Weight | 221.73 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 8-(3-chlorophenyl)-8-azabicyclo[3.2.1]octane |
| SMILES | Clc1cccc(N2C3CCCC2CC3)c1 |
| InChI | InChI=1S/C13H16ClN/c14-10-3-1-6-13(9-10)15-11-4-2-5-12(15)8-7-11/h1,3,6,9,11-12H,2,4-5,7-8H2 |
| InChIKey | SLXAXWPDDABAIM-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.73 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |