About 4-(4-phenylsulfanylcyclohexyl)benzene-1,3-diol
4-(4-phenylsulfanylcyclohexyl)benzene-1,3-diol (PubChem CID 22337810) has the molecular formula C18H20O2S
and a molecular weight of 300.42 g/mol. Its IUPAC name is 4-(4-phenylsulfanylcyclohexyl)benzene-1,3-diol.
Molecular Properties
| Compound Name | 4-(4-phenylsulfanylcyclohexyl)benzene-1,3-diol |
| PubChem CID | 22337810 |
| Molecular Formula | C18H20O2S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 4-(4-phenylsulfanylcyclohexyl)benzene-1,3-diol |
| SMILES | Oc1ccc(C2CCC(Sc3ccccc3)CC2)c(O)c1 |
| InChI | InChI=1S/C18H20O2S/c19-14-8-11-17(18(20)12-14)13-6-9-16(10-7-13)21-15-4-2-1-3-5-15/h1-5,8,11-13,16,19-20H,6-7,9-10H2 |
| InChIKey | BAGFDCMEFJAKBE-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-phenylsulfanylcyclohexyl)benzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-phenylsulfanylcyclohexyl)benzene-1,3-diol?
The IUPAC name of 4-(4-phenylsulfanylcyclohexyl)benzene-1,3-diol (CID 22337810) is 4-(4-phenylsulfanylcyclohexyl)benzene-1,3-diol.
What is the SMILES notation for 4-(4-phenylsulfanylcyclohexyl)benzene-1,3-diol?
The canonical SMILES for 4-(4-phenylsulfanylcyclohexyl)benzene-1,3-diol is Oc1ccc(C2CCC(Sc3ccccc3)CC2)c(O)c1.
What is the InChIKey of 4-(4-phenylsulfanylcyclohexyl)benzene-1,3-diol?
The InChIKey is BAGFDCMEFJAKBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20O2S/c19-14-8-11-17(18(20)12-14)13-6-9-16(10-7-13)21-15-4-2-1-3-5-15/h1-5,8,11-13,16,19-20H,6-7,9-10H2.
What are the key properties of 4-(4-phenylsulfanylcyclohexyl)benzene-1,3-diol?
4-(4-phenylsulfanylcyclohexyl)benzene-1,3-diol has a molecular weight of 300.42 g/mol, XLogP of 4.92, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-phenylsulfanylcyclohexyl)benzene-1,3-diol is sourced from PubChem (CID 22337810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).