About 1-N,4-N-dimethyl-2H-pyridine-1,4-diamine
1-N,4-N-dimethyl-2H-pyridine-1,4-diamine (PubChem CID 22337914) has the molecular formula C7H13N3
and a molecular weight of 139.20 g/mol. Its IUPAC name is 1-N,4-N-dimethyl-2H-pyridine-1,4-diamine.
Molecular Properties
| Compound Name | 1-N,4-N-dimethyl-2H-pyridine-1,4-diamine |
| PubChem CID | 22337914 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | 1-N,4-N-dimethyl-2H-pyridine-1,4-diamine |
| SMILES | CNC1=CCN(NC)C=C1 |
| InChI | InChI=1S/C7H13N3/c1-8-7-3-5-10(9-2)6-4-7/h3-5,8-9H,6H2,1-2H3 |
| InChIKey | BWZHKRSSCFRVIE-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-N,4-N-dimethyl-2H-pyridine-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,4-N-dimethyl-2H-pyridine-1,4-diamine?
The IUPAC name of 1-N,4-N-dimethyl-2H-pyridine-1,4-diamine (CID 22337914) is 1-N,4-N-dimethyl-2H-pyridine-1,4-diamine.
What is the SMILES notation for 1-N,4-N-dimethyl-2H-pyridine-1,4-diamine?
The canonical SMILES for 1-N,4-N-dimethyl-2H-pyridine-1,4-diamine is CNC1=CCN(NC)C=C1.
What is the InChIKey of 1-N,4-N-dimethyl-2H-pyridine-1,4-diamine?
The InChIKey is BWZHKRSSCFRVIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3/c1-8-7-3-5-10(9-2)6-4-7/h3-5,8-9H,6H2,1-2H3.
What are the key properties of 1-N,4-N-dimethyl-2H-pyridine-1,4-diamine?
1-N,4-N-dimethyl-2H-pyridine-1,4-diamine has a molecular weight of 139.20 g/mol, XLogP of 0.05, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,4-N-dimethyl-2H-pyridine-1,4-diamine is sourced from PubChem (CID 22337914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).