C15H9Cl2N — CID 22337970
4,8-dichloro-5,10-dihydroindeno[1,2-b]indole (PubChem CID 22337970) has the molecular formula C15H9Cl2N and a molecular weight of 274.15 g/mol. Its IUPAC name is 4,8-dichloro-5,10-dihydroindeno[1,2-b]indole.
| Compound Name | 4,8-dichloro-5,10-dihydroindeno[1,2-b]indole |
|---|---|
| PubChem CID | 22337970 |
| Molecular Formula | C15H9Cl2N |
| Molecular Weight | 274.15 g/mol |
| Exact Mass | 273.01 |
| IUPAC Name | 4,8-dichloro-5,10-dihydroindeno[1,2-b]indole |
| SMILES | Clc1ccc2[nH]c3c(c2c1)Cc1cccc(Cl)c1-3 |
| InChI | InChI=1S/C15H9Cl2N/c16-9-4-5-13-10(7-9)11-6-8-2-1-3-12(17)14(8)15(11)18-13/h1-5,7,18H,6H2 |
| InChIKey | ZARMNUZMWCBFIC-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.15 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |