C14H16NO5- — CID 2233814
5-(3-methoxycarbonyl-2-methylanilino)-5-oxopentanoate (PubChem CID 2233814) has the molecular formula C14H16NO5- and a molecular weight of 278.28 g/mol. Its IUPAC name is 5-(3-methoxycarbonyl-2-methylanilino)-5-oxopentanoate.
| Compound Name | 5-(3-methoxycarbonyl-2-methylanilino)-5-oxopentanoate |
|---|---|
| PubChem CID | 2233814 |
| Molecular Formula | C14H16NO5- |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 5-(3-methoxycarbonyl-2-methylanilino)-5-oxopentanoate |
| SMILES | COC(=O)c1cccc(NC(=O)CCCC(=O)[O-])c1C |
| InChI | InChI=1S/C14H17NO5/c1-9-10(14(19)20-2)5-3-6-11(9)15-12(16)7-4-8-13(17)18/h3,5-6H,4,7-8H2,1-2H3,(H,15,16)(H,17,18)/p-1 |
| InChIKey | HPBFOYSZXMUTRJ-UHFFFAOYSA-M |
| XLogP | 0.64 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |