About 1,4-bis[4-(3-fluorophenoxy)phenoxy]-2,3-dimethylbenzene
1,4-bis[4-(3-fluorophenoxy)phenoxy]-2,3-dimethylbenzene (PubChem CID 22338505) has the molecular formula C32H24F2O4
and a molecular weight of 510.54 g/mol. Its IUPAC name is 1,4-bis[4-(3-fluorophenoxy)phenoxy]-2,3-dimethylbenzene.
Molecular Properties
| Compound Name | 1,4-bis[4-(3-fluorophenoxy)phenoxy]-2,3-dimethylbenzene |
| PubChem CID | 22338505 |
| Molecular Formula | C32H24F2O4 |
| Molecular Weight | 510.54 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | 1,4-bis[4-(3-fluorophenoxy)phenoxy]-2,3-dimethylbenzene |
| SMILES | Cc1c(Oc2ccc(Oc3cccc(F)c3)cc2)ccc(Oc2ccc(Oc3cccc(F)c3)cc2)c1C |
| InChI | InChI=1S/C32H24F2O4/c1-21-22(2)32(38-28-15-11-26(12-16-28)36-30-8-4-6-24(34)20-30)18-17-31(21)37-27-13-9-25(10-14-27)35-29-7-3-5-23(33)19-29/h3-20H,1-2H3 |
| InChIKey | ZOTKSEAKBNRPMV-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 510.54 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,4-bis[4-(3-fluorophenoxy)phenoxy]-2,3-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis[4-(3-fluorophenoxy)phenoxy]-2,3-dimethylbenzene?
The IUPAC name of 1,4-bis[4-(3-fluorophenoxy)phenoxy]-2,3-dimethylbenzene (CID 22338505) is 1,4-bis[4-(3-fluorophenoxy)phenoxy]-2,3-dimethylbenzene.
What is the SMILES notation for 1,4-bis[4-(3-fluorophenoxy)phenoxy]-2,3-dimethylbenzene?
The canonical SMILES for 1,4-bis[4-(3-fluorophenoxy)phenoxy]-2,3-dimethylbenzene is Cc1c(Oc2ccc(Oc3cccc(F)c3)cc2)ccc(Oc2ccc(Oc3cccc(F)c3)cc2)c1C.
What is the InChIKey of 1,4-bis[4-(3-fluorophenoxy)phenoxy]-2,3-dimethylbenzene?
The InChIKey is ZOTKSEAKBNRPMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H24F2O4/c1-21-22(2)32(38-28-15-11-26(12-16-28)36-30-8-4-6-24(34)20-30)18-17-31(21)37-27-13-9-25(10-14-27)35-29-7-3-5-23(33)19-29/h3-20H,1-2H3.
What are the key properties of 1,4-bis[4-(3-fluorophenoxy)phenoxy]-2,3-dimethylbenzene?
1,4-bis[4-(3-fluorophenoxy)phenoxy]-2,3-dimethylbenzene has a molecular weight of 510.54 g/mol, XLogP of 9.75, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis[4-(3-fluorophenoxy)phenoxy]-2,3-dimethylbenzene is sourced from PubChem (CID 22338505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).