About 5-chloro-2,4,6-tris(ethenylsulfanyl)pyrimidine
5-chloro-2,4,6-tris(ethenylsulfanyl)pyrimidine (PubChem CID 22338668) has the molecular formula C10H9ClN2S3
and a molecular weight of 288.85 g/mol. Its IUPAC name is 5-chloro-2,4,6-tris(ethenylsulfanyl)pyrimidine.
Molecular Properties
| Compound Name | 5-chloro-2,4,6-tris(ethenylsulfanyl)pyrimidine |
| PubChem CID | 22338668 |
| Molecular Formula | C10H9ClN2S3 |
| Molecular Weight | 288.85 g/mol |
| Exact Mass | 287.96 |
| IUPAC Name | 5-chloro-2,4,6-tris(ethenylsulfanyl)pyrimidine |
| SMILES | C=CSc1nc(SC=C)c(Cl)c(SC=C)n1 |
| InChI | InChI=1S/C10H9ClN2S3/c1-4-14-8-7(11)9(15-5-2)13-10(12-8)16-6-3/h4-6H,1-3H2 |
| InChIKey | WRDHGQVETZHTCB-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.85 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-chloro-2,4,6-tris(ethenylsulfanyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2,4,6-tris(ethenylsulfanyl)pyrimidine?
The IUPAC name of 5-chloro-2,4,6-tris(ethenylsulfanyl)pyrimidine (CID 22338668) is 5-chloro-2,4,6-tris(ethenylsulfanyl)pyrimidine.
What is the SMILES notation for 5-chloro-2,4,6-tris(ethenylsulfanyl)pyrimidine?
The canonical SMILES for 5-chloro-2,4,6-tris(ethenylsulfanyl)pyrimidine is C=CSc1nc(SC=C)c(Cl)c(SC=C)n1.
What is the InChIKey of 5-chloro-2,4,6-tris(ethenylsulfanyl)pyrimidine?
The InChIKey is WRDHGQVETZHTCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClN2S3/c1-4-14-8-7(11)9(15-5-2)13-10(12-8)16-6-3/h4-6H,1-3H2.
What are the key properties of 5-chloro-2,4,6-tris(ethenylsulfanyl)pyrimidine?
5-chloro-2,4,6-tris(ethenylsulfanyl)pyrimidine has a molecular weight of 288.85 g/mol, XLogP of 4.84, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2,4,6-tris(ethenylsulfanyl)pyrimidine is sourced from PubChem (CID 22338668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).