C21H20F6N2O8S2 — CID 22339011
[(Z)-[2,2,2-trifluoro-1-[4-[3-[4-[(Z)-N-methylsulfonyloxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]propoxy]phenyl]ethylidene]amino] methanesulfonate (PubChem CID 22339011) has the molecular formula C21H20F6N2O8S2 and a molecular weight of 606.52 g/mol. Its IUPAC name is [(Z)-[2,2,2-trifluoro-1-[4-[3-[4-[(Z)-N-methylsulfonyloxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]propoxy]phenyl]ethylidene]amino] methanesulfonate.
| Compound Name | [(Z)-[2,2,2-trifluoro-1-[4-[3-[4-[(Z)-N-methylsulfonyloxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]propoxy]phenyl]ethylidene]amino] methanesulfonate |
|---|---|
| PubChem CID | 22339011 |
| Molecular Formula | C21H20F6N2O8S2 |
| Molecular Weight | 606.52 g/mol |
| Exact Mass | 606.06 |
| IUPAC Name | [(Z)-[2,2,2-trifluoro-1-[4-[3-[4-[(Z)-N-methylsulfonyloxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]propoxy]phenyl]ethylidene]amino] methanesulfonate |
| SMILES | CS(=O)(=O)O/N=C(/c1ccc(OCCCOc2ccc(/C(=N/OS(C)(=O)=O)C(F)(F)F)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C21H20F6N2O8S2/c1-38(30,31)36-28-18(20(22,23)24)14-4-8-16(9-5-14)34-12-3-13-35-17-10-6-15(7-11-17)19(21(25,26)27)29-37-39(2,32)33/h4-11H,3,12-13H2,1-2H3/b28-18-,29-19- |
| InChIKey | KBFRNLFIZBUAIB-IFEPHKIBSA-N |
| XLogP | 4.02 |
| TPSA | 129.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|