C33H28F6N2O8S2 — CID 22339012
[(Z)-[1-[4-[3-[4-[(Z)-N-benzylsulfonyloxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]propoxy]phenyl]-2,2,2-trifluoroethylidene]amino] phenylmethanesulfonate (PubChem CID 22339012) has the molecular formula C33H28F6N2O8S2 and a molecular weight of 758.72 g/mol. Its IUPAC name is [(Z)-[1-[4-[3-[4-[(Z)-N-benzylsulfonyloxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]propoxy]phenyl]-2,2,2-trifluoroethylidene]amino] phenylmethanesulfonate.
| Compound Name | [(Z)-[1-[4-[3-[4-[(Z)-N-benzylsulfonyloxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]propoxy]phenyl]-2,2,2-trifluoroethylidene]amino] phenylmethanesulfonate |
|---|---|
| PubChem CID | 22339012 |
| Molecular Formula | C33H28F6N2O8S2 |
| Molecular Weight | 758.72 g/mol |
| Exact Mass | 758.12 |
| IUPAC Name | [(Z)-[1-[4-[3-[4-[(Z)-N-benzylsulfonyloxy-C-(trifluoromethyl)carbonimidoyl]phenoxy]propoxy]phenyl]-2,2,2-trifluoroethylidene]amino] phenylmethanesulfonate |
| SMILES | O=S(=O)(Cc1ccccc1)O/N=C(/c1ccc(OCCCOc2ccc(/C(=N/OS(=O)(=O)Cc3ccccc3)C(F)(F)F)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C33H28F6N2O8S2/c34-32(35,36)30(40-48-50(42,43)22-24-8-3-1-4-9-24)26-12-16-28(17-13-26)46-20-7-21-47-29-18-14-27(15-19-29)31(33(37,38)39)41-49-51(44,45)23-25-10-5-2-6-11-25/h1-6,8-19H,7,20-23H2/b40-30-,41-31- |
| InChIKey | VDAJHDLANICSTN-QLVAPADBSA-N |
| XLogP | 7.16 |
| TPSA | 129.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.72 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|