About formyl 2-methylpropanoate
formyl 2-methylpropanoate (PubChem CID 22339057) has the molecular formula C5H8O3
and a molecular weight of 116.12 g/mol. Its IUPAC name is formyl 2-methylpropanoate.
Molecular Properties
| Compound Name | formyl 2-methylpropanoate |
| PubChem CID | 22339057 |
| Molecular Formula | C5H8O3 |
| Molecular Weight | 116.12 g/mol |
| Exact Mass | 116.05 |
| IUPAC Name | formyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC=O |
| InChI | InChI=1S/C5H8O3/c1-4(2)5(7)8-3-6/h3-4H,1-2H3 |
| InChIKey | LFQVLHBYTMVCFT-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.12 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze formyl 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formyl 2-methylpropanoate?
The IUPAC name of formyl 2-methylpropanoate (CID 22339057) is formyl 2-methylpropanoate.
What is the SMILES notation for formyl 2-methylpropanoate?
The canonical SMILES for formyl 2-methylpropanoate is CC(C)C(=O)OC=O.
What is the InChIKey of formyl 2-methylpropanoate?
The InChIKey is LFQVLHBYTMVCFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O3/c1-4(2)5(7)8-3-6/h3-4H,1-2H3.
What are the key properties of formyl 2-methylpropanoate?
formyl 2-methylpropanoate has a molecular weight of 116.12 g/mol, XLogP of 0.34, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formyl 2-methylpropanoate is sourced from PubChem (CID 22339057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).