C21H21Cl2N3O6S — CID 22339391
2-[3,5-dichloro-4-(3-hexylsulfonyl-4-hydroxyphenoxy)phenyl]-1,2,4-triazine-3,5-dione (PubChem CID 22339391) has the molecular formula C21H21Cl2N3O6S and a molecular weight of 514.39 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-(3-hexylsulfonyl-4-hydroxyphenoxy)phenyl]-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[3,5-dichloro-4-(3-hexylsulfonyl-4-hydroxyphenoxy)phenyl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 22339391 |
| Molecular Formula | C21H21Cl2N3O6S |
| Molecular Weight | 514.39 g/mol |
| Exact Mass | 513.05 |
| IUPAC Name | 2-[3,5-dichloro-4-(3-hexylsulfonyl-4-hydroxyphenoxy)phenyl]-1,2,4-triazine-3,5-dione |
| SMILES | CCCCCCS(=O)(=O)c1cc(Oc2c(Cl)cc(-n3ncc(=O)[nH]c3=O)cc2Cl)ccc1O |
| InChI | InChI=1S/C21H21Cl2N3O6S/c1-2-3-4-5-8-33(30,31)18-11-14(6-7-17(18)27)32-20-15(22)9-13(10-16(20)23)26-21(29)25-19(28)12-24-26/h6-7,9-12,27H,2-5,8H2,1H3,(H,25,28,29) |
| InChIKey | OCASUECYXIUWCR-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 131.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|