C9H11NO4 — CID 22339410
2-hydroxy-2-(4-hydroxy-3-methoxyphenyl)acetamide (PubChem CID 22339410) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is 2-hydroxy-2-(4-hydroxy-3-methoxyphenyl)acetamide.
| Compound Name | 2-hydroxy-2-(4-hydroxy-3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 22339410 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 2-hydroxy-2-(4-hydroxy-3-methoxyphenyl)acetamide |
| SMILES | COc1cc(C(O)C(N)=O)ccc1O |
| InChI | InChI=1S/C9H11NO4/c1-14-7-4-5(2-3-6(7)11)8(12)9(10)13/h2-4,8,11-12H,1H3,(H2,10,13) |
| InChIKey | DFWYUZRPFIZLMI-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |