C16H12Cl2N4O4 — CID 22339553
2-[4-(3-amino-4-methoxyphenoxy)-3,5-dichlorophenyl]-1,2,4-triazine-3,5-dione (PubChem CID 22339553) has the molecular formula C16H12Cl2N4O4 and a molecular weight of 395.20 g/mol. Its IUPAC name is 2-[4-(3-amino-4-methoxyphenoxy)-3,5-dichlorophenyl]-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[4-(3-amino-4-methoxyphenoxy)-3,5-dichlorophenyl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 22339553 |
| Molecular Formula | C16H12Cl2N4O4 |
| Molecular Weight | 395.20 g/mol |
| Exact Mass | 394.02 |
| IUPAC Name | 2-[4-(3-amino-4-methoxyphenoxy)-3,5-dichlorophenyl]-1,2,4-triazine-3,5-dione |
| SMILES | COc1ccc(Oc2c(Cl)cc(-n3ncc(=O)[nH]c3=O)cc2Cl)cc1N |
| InChI | InChI=1S/C16H12Cl2N4O4/c1-25-13-3-2-9(6-12(13)19)26-15-10(17)4-8(5-11(15)18)22-16(24)21-14(23)7-20-22/h2-7H,19H2,1H3,(H,21,23,24) |
| InChIKey | PNNATMHVGIVBNV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 112.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.20 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|