About spiro[3H-furan-2,3'-8-azabicyclo[3.2.1]octane]
spiro[3H-furan-2,3'-8-azabicyclo[3.2.1]octane] (PubChem CID 22339768) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is spiro[3H-furan-2,3'-8-azabicyclo[3.2.1]octane].
Molecular Properties
| Compound Name | spiro[3H-furan-2,3'-8-azabicyclo[3.2.1]octane] |
| PubChem CID | 22339768 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | spiro[3H-furan-2,3'-8-azabicyclo[3.2.1]octane] |
| SMILES | C1=COC2(C1)CC1CCC(C2)N1 |
| InChI | InChI=1S/C10H15NO/c1-4-10(12-5-1)6-8-2-3-9(7-10)11-8/h1,5,8-9,11H,2-4,6-7H2 |
| InChIKey | KZXQYPMPPMLMJK-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[3H-furan-2,3'-8-azabicyclo[3.2.1]octane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[3H-furan-2,3'-8-azabicyclo[3.2.1]octane]?
The IUPAC name of spiro[3H-furan-2,3'-8-azabicyclo[3.2.1]octane] (CID 22339768) is spiro[3H-furan-2,3'-8-azabicyclo[3.2.1]octane].
What is the SMILES notation for spiro[3H-furan-2,3'-8-azabicyclo[3.2.1]octane]?
The canonical SMILES for spiro[3H-furan-2,3'-8-azabicyclo[3.2.1]octane] is C1=COC2(C1)CC1CCC(C2)N1.
What is the InChIKey of spiro[3H-furan-2,3'-8-azabicyclo[3.2.1]octane]?
The InChIKey is KZXQYPMPPMLMJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO/c1-4-10(12-5-1)6-8-2-3-9(7-10)11-8/h1,5,8-9,11H,2-4,6-7H2.
What are the key properties of spiro[3H-furan-2,3'-8-azabicyclo[3.2.1]octane]?
spiro[3H-furan-2,3'-8-azabicyclo[3.2.1]octane] has a molecular weight of 165.24 g/mol, XLogP of 1.57, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[3H-furan-2,3'-8-azabicyclo[3.2.1]octane] is sourced from PubChem (CID 22339768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).