About 1-cyclobutyl-1-(2-methylcyclopenta-1,3-dien-1-yl)indene
1-cyclobutyl-1-(2-methylcyclopenta-1,3-dien-1-yl)indene (PubChem CID 22340230) has the molecular formula C19H20
and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-cyclobutyl-1-(2-methylcyclopenta-1,3-dien-1-yl)indene.
Molecular Properties
| Compound Name | 1-cyclobutyl-1-(2-methylcyclopenta-1,3-dien-1-yl)indene |
| PubChem CID | 22340230 |
| Molecular Formula | C19H20 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 1-cyclobutyl-1-(2-methylcyclopenta-1,3-dien-1-yl)indene |
| SMILES | CC1=C(C2(C3CCC3)C=Cc3ccccc32)CC=C1 |
| InChI | InChI=1S/C19H20/c1-14-6-4-11-17(14)19(16-8-5-9-16)13-12-15-7-2-3-10-18(15)19/h2-4,6-7,10,12-13,16H,5,8-9,11H2,1H3 |
| InChIKey | QTJAYSBOYJPZGX-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-cyclobutyl-1-(2-methylcyclopenta-1,3-dien-1-yl)indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclobutyl-1-(2-methylcyclopenta-1,3-dien-1-yl)indene?
The IUPAC name of 1-cyclobutyl-1-(2-methylcyclopenta-1,3-dien-1-yl)indene (CID 22340230) is 1-cyclobutyl-1-(2-methylcyclopenta-1,3-dien-1-yl)indene.
What is the SMILES notation for 1-cyclobutyl-1-(2-methylcyclopenta-1,3-dien-1-yl)indene?
The canonical SMILES for 1-cyclobutyl-1-(2-methylcyclopenta-1,3-dien-1-yl)indene is CC1=C(C2(C3CCC3)C=Cc3ccccc32)CC=C1.
What is the InChIKey of 1-cyclobutyl-1-(2-methylcyclopenta-1,3-dien-1-yl)indene?
The InChIKey is QTJAYSBOYJPZGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20/c1-14-6-4-11-17(14)19(16-8-5-9-16)13-12-15-7-2-3-10-18(15)19/h2-4,6-7,10,12-13,16H,5,8-9,11H2,1H3.
What are the key properties of 1-cyclobutyl-1-(2-methylcyclopenta-1,3-dien-1-yl)indene?
1-cyclobutyl-1-(2-methylcyclopenta-1,3-dien-1-yl)indene has a molecular weight of 248.37 g/mol, XLogP of 5.03, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclobutyl-1-(2-methylcyclopenta-1,3-dien-1-yl)indene is sourced from PubChem (CID 22340230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).