C24H23N5O2 — CID 2234055
1-[3,5-bis(benzylamino)-1,2,4-triazol-1-yl]-2-phenoxyethanone (PubChem CID 2234055) has the molecular formula C24H23N5O2 and a molecular weight of 413.48 g/mol. Its IUPAC name is 1-[3,5-bis(benzylamino)-1,2,4-triazol-1-yl]-2-phenoxyethanone.
| Compound Name | 1-[3,5-bis(benzylamino)-1,2,4-triazol-1-yl]-2-phenoxyethanone |
|---|---|
| PubChem CID | 2234055 |
| Molecular Formula | C24H23N5O2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 1-[3,5-bis(benzylamino)-1,2,4-triazol-1-yl]-2-phenoxyethanone |
| SMILES | O=C(COc1ccccc1)n1nc(NCc2ccccc2)nc1NCc1ccccc1 |
| InChI | InChI=1S/C24H23N5O2/c30-22(18-31-21-14-8-3-9-15-21)29-24(26-17-20-12-6-2-7-13-20)27-23(28-29)25-16-19-10-4-1-5-11-19/h1-15H,16-18H2,(H2,25,26,27,28) |
| InChIKey | KFBAILGURINDQC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |