C36H37NO4 — CID 22340593
2-[2-[4-[4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]butanoyl]phenyl]phenyl]acetic acid (PubChem CID 22340593) has the molecular formula C36H37NO4 and a molecular weight of 547.70 g/mol. Its IUPAC name is 2-[2-[4-[4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]butanoyl]phenyl]phenyl]acetic acid.
| Compound Name | 2-[2-[4-[4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]butanoyl]phenyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 22340593 |
| Molecular Formula | C36H37NO4 |
| Molecular Weight | 547.70 g/mol |
| Exact Mass | 547.27 |
| IUPAC Name | 2-[2-[4-[4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]butanoyl]phenyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccccc1-c1ccc(C(=O)CCCN2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C36H37NO4/c38-34(28-19-17-27(18-20-28)33-15-8-7-10-29(33)26-35(39)40)16-9-23-37-24-21-32(22-25-37)36(41,30-11-3-1-4-12-30)31-13-5-2-6-14-31/h1-8,10-15,17-20,32,41H,9,16,21-26H2,(H,39,40) |
| InChIKey | OBLUSRFFVQQREQ-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.70 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |