About 2,7-dibromo-9,9-bis(2-methylpropyl)fluorene
2,7-dibromo-9,9-bis(2-methylpropyl)fluorene (PubChem CID 22340866) has the molecular formula C21H24Br2
and a molecular weight of 436.23 g/mol. Its IUPAC name is 2,7-dibromo-9,9-bis(2-methylpropyl)fluorene.
Molecular Properties
| Compound Name | 2,7-dibromo-9,9-bis(2-methylpropyl)fluorene |
| PubChem CID | 22340866 |
| Molecular Formula | C21H24Br2 |
| Molecular Weight | 436.23 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | 2,7-dibromo-9,9-bis(2-methylpropyl)fluorene |
| SMILES | CC(C)CC1(CC(C)C)c2cc(Br)ccc2-c2ccc(Br)cc21 |
| InChI | InChI=1S/C21H24Br2/c1-13(2)11-21(12-14(3)4)19-9-15(22)5-7-17(19)18-8-6-16(23)10-20(18)21/h5-10,13-14H,11-12H2,1-4H3 |
| InChIKey | ONGJWHZCXXZDKP-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.23 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,7-dibromo-9,9-bis(2-methylpropyl)fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dibromo-9,9-bis(2-methylpropyl)fluorene?
The IUPAC name of 2,7-dibromo-9,9-bis(2-methylpropyl)fluorene (CID 22340866) is 2,7-dibromo-9,9-bis(2-methylpropyl)fluorene.
What is the SMILES notation for 2,7-dibromo-9,9-bis(2-methylpropyl)fluorene?
The canonical SMILES for 2,7-dibromo-9,9-bis(2-methylpropyl)fluorene is CC(C)CC1(CC(C)C)c2cc(Br)ccc2-c2ccc(Br)cc21.
What is the InChIKey of 2,7-dibromo-9,9-bis(2-methylpropyl)fluorene?
The InChIKey is ONGJWHZCXXZDKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24Br2/c1-13(2)11-21(12-14(3)4)19-9-15(22)5-7-17(19)18-8-6-16(23)10-20(18)21/h5-10,13-14H,11-12H2,1-4H3.
What are the key properties of 2,7-dibromo-9,9-bis(2-methylpropyl)fluorene?
2,7-dibromo-9,9-bis(2-methylpropyl)fluorene has a molecular weight of 436.23 g/mol, XLogP of 7.57, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dibromo-9,9-bis(2-methylpropyl)fluorene is sourced from PubChem (CID 22340866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).