C13H13Cl2N3O4S2 — CID 22341129
6,7-dichloro-N-(1,1-dioxothiolan-3-yl)-3-methylsulfonylquinoxalin-2-amine (PubChem CID 22341129) has the molecular formula C13H13Cl2N3O4S2 and a molecular weight of 410.30 g/mol. Its IUPAC name is 6,7-dichloro-N-(1,1-dioxothiolan-3-yl)-3-methylsulfonylquinoxalin-2-amine.
| Compound Name | 6,7-dichloro-N-(1,1-dioxothiolan-3-yl)-3-methylsulfonylquinoxalin-2-amine |
|---|---|
| PubChem CID | 22341129 |
| Molecular Formula | C13H13Cl2N3O4S2 |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 408.97 |
| IUPAC Name | 6,7-dichloro-N-(1,1-dioxothiolan-3-yl)-3-methylsulfonylquinoxalin-2-amine |
| SMILES | CS(=O)(=O)c1nc2cc(Cl)c(Cl)cc2nc1NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H13Cl2N3O4S2/c1-23(19,20)13-12(16-7-2-3-24(21,22)6-7)17-10-4-8(14)9(15)5-11(10)18-13/h4-5,7H,2-3,6H2,1H3,(H,16,17) |
| InChIKey | WMPGWGFKQWRGHO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |