C21H23ClN4O3 — CID 22341299
N-(1-adamantylmethyl)-2-chloro-5-(3,5-dioxo-1,2,4-triazin-2-yl)benzamide (PubChem CID 22341299) has the molecular formula C21H23ClN4O3 and a molecular weight of 414.89 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-2-chloro-5-(3,5-dioxo-1,2,4-triazin-2-yl)benzamide.
| Compound Name | N-(1-adamantylmethyl)-2-chloro-5-(3,5-dioxo-1,2,4-triazin-2-yl)benzamide |
|---|---|
| PubChem CID | 22341299 |
| Molecular Formula | C21H23ClN4O3 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | N-(1-adamantylmethyl)-2-chloro-5-(3,5-dioxo-1,2,4-triazin-2-yl)benzamide |
| SMILES | O=C(NCC12CC3CC(CC(C3)C1)C2)c1cc(-n2ncc(=O)[nH]c2=O)ccc1Cl |
| InChI | InChI=1S/C21H23ClN4O3/c22-17-2-1-15(26-20(29)25-18(27)10-24-26)6-16(17)19(28)23-11-21-7-12-3-13(8-21)5-14(4-12)9-21/h1-2,6,10,12-14H,3-5,7-9,11H2,(H,23,28)(H,25,27,29) |
| InChIKey | HMZMHYDSYWEFGN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |