C6H14N4 — CID 22341334
1,2,3,4,4a,5,6,7,8,8a-decahydropteridine (PubChem CID 22341334) has the molecular formula C6H14N4 and a molecular weight of 142.21 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydropteridine.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydropteridine |
|---|---|
| PubChem CID | 22341334 |
| Molecular Formula | C6H14N4 |
| Molecular Weight | 142.21 g/mol |
| Exact Mass | 142.12 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydropteridine |
| SMILES | C1CNC2NCNCC2N1 |
| InChI | InChI=1S/C6H14N4/c1-2-9-6-5(8-1)3-7-4-10-6/h5-10H,1-4H2 |
| InChIKey | IWHIJKAYQCQXHD-UHFFFAOYSA-N |
| XLogP | -1.98 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.21 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |