C23H18N2O4S — CID 22341418
[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]phenyl]-phenylcarbamic acid (PubChem CID 22341418) has the molecular formula C23H18N2O4S and a molecular weight of 418.47 g/mol. Its IUPAC name is [3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]phenyl]-phenylcarbamic acid.
| Compound Name | [3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]phenyl]-phenylcarbamic acid |
|---|---|
| PubChem CID | 22341418 |
| Molecular Formula | C23H18N2O4S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | [3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]phenyl]-phenylcarbamic acid |
| SMILES | O=C1NC(=O)C(Cc2ccc(-c3cccc(N(C(=O)O)c4ccccc4)c3)cc2)S1 |
| InChI | InChI=1S/C23H18N2O4S/c26-21-20(30-22(27)24-21)13-15-9-11-16(12-10-15)17-5-4-8-19(14-17)25(23(28)29)18-6-2-1-3-7-18/h1-12,14,20H,13H2,(H,28,29)(H,24,26,27) |
| InChIKey | CQZZKBPIBOHEAB-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|